C24H27HgN5O3PS — CID 142871259
[2-[4-[[5-(2-hydroxyphenyl)-3-phosphanylpyrazolo[1,5-a]pyrimidin-7-yl]amino]butylsulfamoyl]-3,5-dimethylphenyl]mercury (PubChem CID 142871259) has the molecular formula C24H27HgN5O3PS and a molecular weight of 697.14 g/mol. Its IUPAC name is [2-[4-[[5-(2-hydroxyphenyl)-3-phosphanylpyrazolo[1,5-a]pyrimidin-7-yl]amino]butylsulfamoyl]-3,5-dimethylphenyl]mercury.
| Compound Name | [2-[4-[[5-(2-hydroxyphenyl)-3-phosphanylpyrazolo[1,5-a]pyrimidin-7-yl]amino]butylsulfamoyl]-3,5-dimethylphenyl]mercury |
|---|---|
| PubChem CID | 142871259 |
| Molecular Formula | C24H27HgN5O3PS |
| Molecular Weight | 697.14 g/mol |
| Exact Mass | 698.13 |
| IUPAC Name | [2-[4-[[5-(2-hydroxyphenyl)-3-phosphanylpyrazolo[1,5-a]pyrimidin-7-yl]amino]butylsulfamoyl]-3,5-dimethylphenyl]mercury |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCCCCNc2cc(-c3ccccc3O)nc3c(P)cnn23)c([Hg])c1 |
| InChI | InChI=1S/C24H27N5O3PS.Hg/c1-16-9-10-22(17(2)13-16)34(31,32)27-12-6-5-11-25-23-14-19(18-7-3-4-8-20(18)30)28-24-21(33)15-26-29(23)24;/h3-4,7-9,13-15,25,27,30H,5-6,11-12,33H2,1-2H3; |
| InChIKey | OHNMRHKABWNHLN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.14 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|