C26H32N5OPS — CID 145499591
N'-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]-N-[5-(2-methylphenyl)-3-methylphosphanylpyrazolo[1,5-a]pyrimidin-7-yl]butane-1,4-diamine (PubChem CID 145499591) has the molecular formula C26H32N5OPS and a molecular weight of 493.62 g/mol. Its IUPAC name is N'-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]-N-[5-(2-methylphenyl)-3-methylphosphanylpyrazolo[1,5-a]pyrimidin-7-yl]butane-1,4-diamine.
| Compound Name | N'-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]-N-[5-(2-methylphenyl)-3-methylphosphanylpyrazolo[1,5-a]pyrimidin-7-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 145499591 |
| Molecular Formula | C26H32N5OPS |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | N'-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]-N-[5-(2-methylphenyl)-3-methylphosphanylpyrazolo[1,5-a]pyrimidin-7-yl]butane-1,4-diamine |
| SMILES | C=S(=O)(NCCCCNc1cc(-c2ccccc2C)nc2c(PC)cnn12)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H32N5OPS/c1-19-11-13-21(14-12-19)34(4,32)29-16-8-7-15-27-25-17-23(22-10-6-5-9-20(22)2)30-26-24(33-3)18-28-31(25)26/h5-6,9-14,17-18,27,33H,4,7-8,15-16H2,1-3H3,(H,29,32) |
| InChIKey | ARFQTSIOVUFOSQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|