C27H25N5O3S — CID 163872773
N-[2-[[5-(2-hydroxyphenyl)-3-methylpyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-4-phenylbenzenesulfonamide (PubChem CID 163872773) has the molecular formula C27H25N5O3S and a molecular weight of 499.60 g/mol. Its IUPAC name is N-[2-[[5-(2-hydroxyphenyl)-3-methylpyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-4-phenylbenzenesulfonamide.
| Compound Name | N-[2-[[5-(2-hydroxyphenyl)-3-methylpyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-4-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 163872773 |
| Molecular Formula | C27H25N5O3S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | N-[2-[[5-(2-hydroxyphenyl)-3-methylpyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-4-phenylbenzenesulfonamide |
| SMILES | Cc1cnn2c(NCCNS(=O)(=O)c3ccc(-c4ccccc4)cc3)cc(-c3ccccc3O)nc12 |
| InChI | InChI=1S/C27H25N5O3S/c1-19-18-29-32-26(17-24(31-27(19)32)23-9-5-6-10-25(23)33)28-15-16-30-36(34,35)22-13-11-21(12-14-22)20-7-3-2-4-8-20/h2-14,17-18,28,30,33H,15-16H2,1H3 |
| InChIKey | PMHAIVSIGWUEBP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|