About CID 89055853
CID 89055853 (PubChem CID 89055853) has the molecular formula C20H15BCl3N5O2S
and a molecular weight of 506.61 g/mol.
Molecular Properties
| Compound Name | CID 89055853 |
| PubChem CID | 89055853 |
| Molecular Formula | C20H15BCl3N5O2S |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 505.01 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCCNS(=O)(=O)c3ccc(Cl)c(Cl)c3)cc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C20H15BCl3N5O2S/c21-14-11-26-29-19(10-18(28-20(14)29)13-3-1-2-4-15(13)22)25-7-8-27-32(30,31)12-5-6-16(23)17(24)9-12/h1-6,9-11,25,27H,7-8H2 |
| InChIKey | UWZRJYDZIXWFMV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89055853 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89055853?
The IUPAC name of CID 89055853 (CID 89055853) is not available.
What is the SMILES notation for CID 89055853?
The canonical SMILES for CID 89055853 is [B]c1cnn2c(NCCNS(=O)(=O)c3ccc(Cl)c(Cl)c3)cc(-c3ccccc3Cl)nc12.
What is the InChIKey of CID 89055853?
The InChIKey is UWZRJYDZIXWFMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15BCl3N5O2S/c21-14-11-26-29-19(10-18(28-20(14)29)13-3-1-2-4-15(13)22)25-7-8-27-32(30,31)12-5-6-16(23)17(24)9-12/h1-6,9-11,25,27H,7-8H2.
What are the key properties of CID 89055853?
CID 89055853 has a molecular weight of 506.61 g/mol, XLogP of 3.54, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89055853 is sourced from PubChem (CID 89055853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).