About CID 89055508
CID 89055508 (PubChem CID 89055508) has the molecular formula C29H27BClN5O2S
and a molecular weight of 555.90 g/mol.
Molecular Properties
| Compound Name | CID 89055508 |
| PubChem CID | 89055508 |
| Molecular Formula | C29H27BClN5O2S |
| Molecular Weight | 555.90 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCc3cccc(CNS(=O)(=O)c4ccc(C(C)C)cc4)c3)cc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C29H27BClN5O2S/c1-19(2)22-10-12-23(13-11-22)39(37,38)34-17-21-7-5-6-20(14-21)16-32-28-15-27(24-8-3-4-9-26(24)31)35-29-25(30)18-33-36(28)29/h3-15,18-19,32,34H,16-17H2,1-2H3 |
| InChIKey | UYHIAQOACPKYBP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 555.90 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89055508 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89055508?
The IUPAC name of CID 89055508 (CID 89055508) is not available.
What is the SMILES notation for CID 89055508?
The canonical SMILES for CID 89055508 is [B]c1cnn2c(NCc3cccc(CNS(=O)(=O)c4ccc(C(C)C)cc4)c3)cc(-c3ccccc3Cl)nc12.
What is the InChIKey of CID 89055508?
The InChIKey is UYHIAQOACPKYBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H27BClN5O2S/c1-19(2)22-10-12-23(13-11-22)39(37,38)34-17-21-7-5-6-20(14-21)16-32-28-15-27(24-8-3-4-9-26(24)31)35-29-25(30)18-33-36(28)29/h3-15,18-19,32,34H,16-17H2,1-2H3.
What are the key properties of CID 89055508?
CID 89055508 has a molecular weight of 555.90 g/mol, XLogP of 5.06, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89055508 is sourced from PubChem (CID 89055508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).