C29H26BClN6O — CID 89055752
CID 89055752 (PubChem CID 89055752) has the molecular formula C29H26BClN6O and a molecular weight of 520.83 g/mol.
| Compound Name | CID 89055752 |
|---|---|
| PubChem CID | 89055752 |
| Molecular Formula | C29H26BClN6O |
| Molecular Weight | 520.83 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCc3ccc(CNC(=O)N[C@H](C)c4ccccc4)cc3)cc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C29H26BClN6O/c1-19(22-7-3-2-4-8-22)35-29(38)33-17-21-13-11-20(12-14-21)16-32-27-15-26(23-9-5-6-10-25(23)31)36-28-24(30)18-34-37(27)28/h2-15,18-19,32H,16-17H2,1H3,(H2,33,35,38)/t19-/m1/s1 |
| InChIKey | JGGGGNARUNEQJG-LJQANCHMSA-N |
| XLogP | 5.02 |
| TPSA | 83.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.83 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|