C31H24BClN6O2 — CID 89055333
CID 89055333 (PubChem CID 89055333) has the molecular formula C31H24BClN6O2 and a molecular weight of 558.84 g/mol.
| Compound Name | CID 89055333 |
|---|---|
| PubChem CID | 89055333 |
| Molecular Formula | C31H24BClN6O2 |
| Molecular Weight | 558.84 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCc3ccc(CNC(=O)c4c(-c5ccccc5)noc4C)cc3)cc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C31H24BClN6O2/c1-19-28(29(38-41-19)22-7-3-2-4-8-22)31(40)35-17-21-13-11-20(12-14-21)16-34-27-15-26(23-9-5-6-10-25(23)33)37-30-24(32)18-36-39(27)30/h2-15,18,34H,16-17H2,1H3,(H,35,40) |
| InChIKey | DLOTYDFOHMOCJH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.84 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|