C27H20BCl2N5O — CID 89055259
CID 89055259 (PubChem CID 89055259) has the molecular formula C27H20BCl2N5O and a molecular weight of 512.21 g/mol.
| Compound Name | CID 89055259 |
|---|---|
| PubChem CID | 89055259 |
| Molecular Formula | C27H20BCl2N5O |
| Molecular Weight | 512.21 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCc3ccc(CNC(=O)c4ccc(Cl)cc4)cc3)cc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C27H20BCl2N5O/c28-22-16-33-35-25(13-24(34-26(22)35)21-3-1-2-4-23(21)30)31-14-17-5-7-18(8-6-17)15-32-27(36)19-9-11-20(29)12-10-19/h1-13,16,31H,14-15H2,(H,32,36) |
| InChIKey | YRHWCRRTWFFTJB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.21 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|