About CID 89055268
CID 89055268 (PubChem CID 89055268) has the molecular formula C21H19BClN5OS
and a molecular weight of 435.75 g/mol.
Molecular Properties
| Compound Name | CID 89055268 |
| PubChem CID | 89055268 |
| Molecular Formula | C21H19BClN5OS |
| Molecular Weight | 435.75 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCCCCNC(=O)c3cccs3)cc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C21H19BClN5OS/c22-15-13-26-28-19(12-17(27-20(15)28)14-6-1-2-7-16(14)23)24-9-3-4-10-25-21(29)18-8-5-11-30-18/h1-2,5-8,11-13,24H,3-4,9-10H2,(H,25,29) |
| InChIKey | COFMQTWIZJBJGN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.75 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89055268 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89055268?
The IUPAC name of CID 89055268 (CID 89055268) is not available.
What is the SMILES notation for CID 89055268?
The canonical SMILES for CID 89055268 is [B]c1cnn2c(NCCCCNC(=O)c3cccs3)cc(-c3ccccc3Cl)nc12.
What is the InChIKey of CID 89055268?
The InChIKey is COFMQTWIZJBJGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19BClN5OS/c22-15-13-26-28-19(12-17(27-20(15)28)14-6-1-2-7-16(14)23)24-9-3-4-10-25-21(29)18-8-5-11-30-18/h1-2,5-8,11-13,24H,3-4,9-10H2,(H,25,29).
What are the key properties of CID 89055268?
CID 89055268 has a molecular weight of 435.75 g/mol, XLogP of 3.53, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89055268 is sourced from PubChem (CID 89055268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).