C22H21BClN5O4S2 — CID 89055654
CID 89055654 (PubChem CID 89055654) has the molecular formula C22H21BClN5O4S2 and a molecular weight of 529.84 g/mol.
| Compound Name | CID 89055654 |
|---|---|
| PubChem CID | 89055654 |
| Molecular Formula | C22H21BClN5O4S2 |
| Molecular Weight | 529.84 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCCCN(C)S(=O)(=O)c3ccsc3C(=O)OC)cc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C22H21BClN5O4S2/c1-28(35(31,32)18-8-11-34-20(18)22(30)33-2)10-5-9-25-19-12-17(14-6-3-4-7-16(14)24)27-21-15(23)13-26-29(19)21/h3-4,6-8,11-13,25H,5,9-10H2,1-2H3 |
| InChIKey | VVJXXDJOIZJDID-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.84 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|