C20H19BClN5O2S2 — CID 89055645
CID 89055645 (PubChem CID 89055645) has the molecular formula C20H19BClN5O2S2 and a molecular weight of 471.80 g/mol.
| Compound Name | CID 89055645 |
|---|---|
| PubChem CID | 89055645 |
| Molecular Formula | C20H19BClN5O2S2 |
| Molecular Weight | 471.80 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCCCN(C)S(=O)(=O)c3cccs3)cc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C20H19BClN5O2S2/c1-26(31(28,29)19-8-4-11-30-19)10-5-9-23-18-12-17(14-6-2-3-7-16(14)22)25-20-15(21)13-24-27(18)20/h2-4,6-8,11-13,23H,5,9-10H2,1H3 |
| InChIKey | JRGHAGDDLBDVSS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.80 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|