C20H24BrClN6O — CID 21065823
1-[4-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]butyl]-3-propan-2-ylurea (PubChem CID 21065823) has the molecular formula C20H24BrClN6O and a molecular weight of 479.81 g/mol. Its IUPAC name is 1-[4-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]butyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]butyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 21065823 |
| Molecular Formula | C20H24BrClN6O |
| Molecular Weight | 479.81 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 1-[4-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]butyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NCCCCNc1cc(-c2ccccc2Cl)nc2c(Br)cnn12 |
| InChI | InChI=1S/C20H24BrClN6O/c1-13(2)26-20(29)24-10-6-5-9-23-18-11-17(14-7-3-4-8-16(14)22)27-19-15(21)12-25-28(18)19/h3-4,7-8,11-13,23H,5-6,9-10H2,1-2H3,(H2,24,26,29) |
| InChIKey | VFIIYJISNAJUKH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 83.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.81 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|