C26H26BrClN6O — CID 70877231
1-[4-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]butyl]-3-[(1R,2S)-2-phenylcyclopropyl]urea (PubChem CID 70877231) has the molecular formula C26H26BrClN6O and a molecular weight of 553.89 g/mol. Its IUPAC name is 1-[4-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]butyl]-3-[(1R,2S)-2-phenylcyclopropyl]urea.
| Compound Name | 1-[4-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]butyl]-3-[(1R,2S)-2-phenylcyclopropyl]urea |
|---|---|
| PubChem CID | 70877231 |
| Molecular Formula | C26H26BrClN6O |
| Molecular Weight | 553.89 g/mol |
| Exact Mass | 552.10 |
| IUPAC Name | 1-[4-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]butyl]-3-[(1R,2S)-2-phenylcyclopropyl]urea |
| SMILES | O=C(NCCCCNc1cc(-c2ccccc2Cl)nc2c(Br)cnn12)N[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C26H26BrClN6O/c27-20-16-31-34-24(15-23(32-25(20)34)18-10-4-5-11-21(18)28)29-12-6-7-13-30-26(35)33-22-14-19(22)17-8-2-1-3-9-17/h1-5,8-11,15-16,19,22,29H,6-7,12-14H2,(H2,30,33,35)/t19-,22+/m0/s1 |
| InChIKey | OVRGWKNAWZZLBG-SIKLNZKXSA-N |
| XLogP | 5.86 |
| TPSA | 83.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.89 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|