C21H17BClF2N5O2S — CID 89297950
CID 89297950 (PubChem CID 89297950) has the molecular formula C21H17BClF2N5O2S and a molecular weight of 487.73 g/mol.
| Compound Name | CID 89297950 |
|---|---|
| PubChem CID | 89297950 |
| Molecular Formula | C21H17BClF2N5O2S |
| Molecular Weight | 487.73 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCCCNS(=O)(=O)c3ccc(F)cc3F)cc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C21H17BClF2N5O2S/c22-15-12-27-30-20(11-18(29-21(15)30)14-4-1-2-5-16(14)23)26-8-3-9-28-33(31,32)19-7-6-13(24)10-17(19)25/h1-2,4-7,10-12,26,28H,3,8-9H2 |
| InChIKey | GFVHQAGLMCKTJT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.73 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|