C29H22BClN6O — CID 89055264
CID 89055264 (PubChem CID 89055264) has the molecular formula C29H22BClN6O and a molecular weight of 516.80 g/mol.
| Compound Name | CID 89055264 |
|---|---|
| PubChem CID | 89055264 |
| Molecular Formula | C29H22BClN6O |
| Molecular Weight | 516.80 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCc3ccc(CNC(=O)c4cc5ccccc5[nH]4)cc3)cc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C29H22BClN6O/c30-22-17-34-37-27(14-25(36-28(22)37)21-6-2-3-7-23(21)31)32-15-18-9-11-19(12-10-18)16-33-29(38)26-13-20-5-1-4-8-24(20)35-26/h1-14,17,32,35H,15-16H2,(H,33,38) |
| InChIKey | HVSGWKZMJRGWMT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.80 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|