C26H21BClN5O3S — CID 89055906
CID 89055906 (PubChem CID 89055906) has the molecular formula C26H21BClN5O3S and a molecular weight of 529.82 g/mol.
| Compound Name | CID 89055906 |
|---|---|
| PubChem CID | 89055906 |
| Molecular Formula | C26H21BClN5O3S |
| Molecular Weight | 529.82 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCc3cccc(NS(=O)(=O)c4cccc(OC)c4)c3)cc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C26H21BClN5O3S/c1-36-19-8-5-9-20(13-19)37(34,35)32-18-7-4-6-17(12-18)15-29-25-14-24(21-10-2-3-11-23(21)28)31-26-22(27)16-30-33(25)26/h2-14,16,29,32H,15H2,1H3 |
| InChIKey | ATAHCCDXTXVRDB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.82 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|