C24H21N5O3 — CID 143441920
N-[2-[[5-(2-hydroxyphenyl)-3-methylpyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-1-benzofuran-2-carboxamide (PubChem CID 143441920) has the molecular formula C24H21N5O3 and a molecular weight of 427.46 g/mol. Its IUPAC name is N-[2-[[5-(2-hydroxyphenyl)-3-methylpyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-[[5-(2-hydroxyphenyl)-3-methylpyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 143441920 |
| Molecular Formula | C24H21N5O3 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N-[2-[[5-(2-hydroxyphenyl)-3-methylpyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1cnn2c(NCCNC(=O)c3cc4ccccc4o3)cc(-c3ccccc3O)nc12 |
| InChI | InChI=1S/C24H21N5O3/c1-15-14-27-29-22(13-18(28-23(15)29)17-7-3-4-8-19(17)30)25-10-11-26-24(31)21-12-16-6-2-5-9-20(16)32-21/h2-9,12-14,25,30H,10-11H2,1H3,(H,26,31) |
| InChIKey | HVYGHYWCGYIFTE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|