C22H19BrClN5OS — CID 21067439
N-[2-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-2-methylsulfanylbenzamide (PubChem CID 21067439) has the molecular formula C22H19BrClN5OS and a molecular weight of 516.85 g/mol. Its IUPAC name is N-[2-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-2-methylsulfanylbenzamide.
| Compound Name | N-[2-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-2-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 21067439 |
| Molecular Formula | C22H19BrClN5OS |
| Molecular Weight | 516.85 g/mol |
| Exact Mass | 515.02 |
| IUPAC Name | N-[2-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-2-methylsulfanylbenzamide |
| SMILES | CSc1ccccc1C(=O)NCCNc1cc(-c2ccccc2Cl)nc2c(Br)cnn12 |
| InChI | InChI=1S/C22H19BrClN5OS/c1-31-19-9-5-3-7-15(19)22(30)26-11-10-25-20-12-18(14-6-2-4-8-17(14)24)28-21-16(23)13-27-29(20)21/h2-9,12-13,25H,10-11H2,1H3,(H,26,30) |
| InChIKey | KNIUKMAJWOALBD-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.85 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|