C24H21BN6O — CID 89055318
CID 89055318 (PubChem CID 89055318) has the molecular formula C24H21BN6O and a molecular weight of 420.29 g/mol.
| Compound Name | CID 89055318 |
|---|---|
| PubChem CID | 89055318 |
| Molecular Formula | C24H21BN6O |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCCNC(=O)c3c[nH]c4ccccc34)cc(-c3ccccc3C)nc12 |
| InChI | InChI=1S/C24H21BN6O/c1-15-6-2-3-7-16(15)21-12-22(31-23(30-21)19(25)14-29-31)26-10-11-27-24(32)18-13-28-20-9-5-4-8-17(18)20/h2-9,12-14,26,28H,10-11H2,1H3,(H,27,32) |
| InChIKey | UZGVCTLSQMUPMC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|