About CID 136633888
CID 136633888 (PubChem CID 136633888) has the molecular formula C27H25BFN5O
and a molecular weight of 465.34 g/mol.
Molecular Properties
| Compound Name | CID 136633888 |
| PubChem CID | 136633888 |
| Molecular Formula | C27H25BFN5O |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCCCN(CF)Cc3cccc4ccccc34)cc(-c3ccccc3O)nc12 |
| InChI | InChI=1S/C27H25BFN5O/c28-23-16-31-34-26(15-24(32-27(23)34)22-11-3-4-12-25(22)35)30-13-6-14-33(18-29)17-20-9-5-8-19-7-1-2-10-21(19)20/h1-5,7-12,15-16,30,35H,6,13-14,17-18H2 |
| InChIKey | NNGQWDCMLZGDGX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze CID 136633888 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136633888?
The IUPAC name of CID 136633888 (CID 136633888) is not available.
What is the SMILES notation for CID 136633888?
The canonical SMILES for CID 136633888 is [B]c1cnn2c(NCCCN(CF)Cc3cccc4ccccc34)cc(-c3ccccc3O)nc12.
What is the InChIKey of CID 136633888?
The InChIKey is NNGQWDCMLZGDGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25BFN5O/c28-23-16-31-34-26(15-24(32-27(23)34)22-11-3-4-12-25(22)35)30-13-6-14-33(18-29)17-20-9-5-8-19-7-1-2-10-21(19)20/h1-5,7-12,15-16,30,35H,6,13-14,17-18H2.
What are the key properties of CID 136633888?
CID 136633888 has a molecular weight of 465.34 g/mol, XLogP of 4.28, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136633888 is sourced from PubChem (CID 136633888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).