C27H28BN5O2 — CID 136593995
CID 136593995 (PubChem CID 136593995) has the molecular formula C27H28BN5O2 and a molecular weight of 465.37 g/mol.
| Compound Name | CID 136593995 |
|---|---|
| PubChem CID | 136593995 |
| Molecular Formula | C27H28BN5O2 |
| Molecular Weight | 465.37 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCCNC(=O)C(c3ccccc3)C3CCCC3)cc(-c3ccccc3O)nc12 |
| InChI | InChI=1S/C27H28BN5O2/c28-21-17-31-33-24(16-22(32-26(21)33)20-12-6-7-13-23(20)34)29-14-15-30-27(35)25(19-10-4-5-11-19)18-8-2-1-3-9-18/h1-3,6-9,12-13,16-17,19,25,29,34H,4-5,10-11,14-15H2,(H,30,35) |
| InChIKey | UUXIGPHMMMKACR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|