C24H23BN6O2 — CID 136594029
CID 136594029 (PubChem CID 136594029) has the molecular formula C24H23BN6O2 and a molecular weight of 438.30 g/mol.
| Compound Name | CID 136594029 |
|---|---|
| PubChem CID | 136594029 |
| Molecular Formula | C24H23BN6O2 |
| Molecular Weight | 438.30 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCC3CCCN(C(=O)c4ccncc4)C3)cc(-c3ccccc3O)nc12 |
| InChI | InChI=1S/C24H23BN6O2/c25-19-14-28-31-22(12-20(29-23(19)31)18-5-1-2-6-21(18)32)27-13-16-4-3-11-30(15-16)24(33)17-7-9-26-10-8-17/h1-2,5-10,12,14,16,27,32H,3-4,11,13,15H2 |
| InChIKey | HEXOAGCZXCNERQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|