C19H21BN6O — CID 89055129
CID 89055129 (PubChem CID 89055129) has the molecular formula C19H21BN6O and a molecular weight of 360.23 g/mol.
| Compound Name | CID 89055129 |
|---|---|
| PubChem CID | 89055129 |
| Molecular Formula | C19H21BN6O |
| Molecular Weight | 360.23 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCC3CCCN(C(N)=O)C3)cc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C19H21BN6O/c20-15-11-23-26-17(22-10-13-5-4-8-25(12-13)19(21)27)9-16(24-18(15)26)14-6-2-1-3-7-14/h1-3,6-7,9,11,13,22H,4-5,8,10,12H2,(H2,21,27) |
| InChIKey | BWGIEGKSAQHWKY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 88.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|