C24H23BClN5O2S — CID 89055607
CID 89055607 (PubChem CID 89055607) has the molecular formula C24H23BClN5O2S and a molecular weight of 491.81 g/mol.
| Compound Name | CID 89055607 |
|---|---|
| PubChem CID | 89055607 |
| Molecular Formula | C24H23BClN5O2S |
| Molecular Weight | 491.81 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCC3CCCN(S(=O)(=O)c4ccccc4)C3)cc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C24H23BClN5O2S/c25-20-15-28-31-23(13-22(29-24(20)31)19-10-4-5-11-21(19)26)27-14-17-7-6-12-30(16-17)34(32,33)18-8-2-1-3-9-18/h1-5,8-11,13,15,17,27H,6-7,12,14,16H2 |
| InChIKey | MYXZRTIOUABMLV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.81 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|