C23H27BClN5O — CID 89056111
CID 89056111 (PubChem CID 89056111) has the molecular formula C23H27BClN5O and a molecular weight of 435.77 g/mol.
| Compound Name | CID 89056111 |
|---|---|
| PubChem CID | 89056111 |
| Molecular Formula | C23H27BClN5O |
| Molecular Weight | 435.77 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCC3CCCN(C4CCOCC4)C3)cc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C23H27BClN5O/c24-19-14-27-30-22(12-21(28-23(19)30)18-5-1-2-6-20(18)25)26-13-16-4-3-9-29(15-16)17-7-10-31-11-8-17/h1-2,5-6,12,14,16-17,26H,3-4,7-11,13,15H2 |
| InChIKey | LQYOUROZZJRVJE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 54.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.77 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|