C28H25BClN5O2S — CID 89055606
CID 89055606 (PubChem CID 89055606) has the molecular formula C28H25BClN5O2S and a molecular weight of 541.87 g/mol.
| Compound Name | CID 89055606 |
|---|---|
| PubChem CID | 89055606 |
| Molecular Formula | C28H25BClN5O2S |
| Molecular Weight | 541.87 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCC3CCCN(S(=O)(=O)c4cccc5ccccc45)C3)cc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C28H25BClN5O2S/c29-23-17-32-35-27(15-25(33-28(23)35)22-11-3-4-12-24(22)30)31-16-19-7-6-14-34(18-19)38(36,37)26-13-5-9-20-8-1-2-10-21(20)26/h1-5,8-13,15,17,19,31H,6-7,14,16,18H2 |
| InChIKey | JDQVYGWTCFEHFY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.87 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|