C24H21BClF2N5O2S — CID 89055902
CID 89055902 (PubChem CID 89055902) has the molecular formula C24H21BClF2N5O2S and a molecular weight of 527.79 g/mol.
| Compound Name | CID 89055902 |
|---|---|
| PubChem CID | 89055902 |
| Molecular Formula | C24H21BClF2N5O2S |
| Molecular Weight | 527.79 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCC3CCCN(S(=O)(=O)c4ccc(F)c(F)c4)C3)cc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C24H21BClF2N5O2S/c25-18-13-30-33-23(11-22(31-24(18)33)17-5-1-2-6-19(17)26)29-12-15-4-3-9-32(14-15)36(34,35)16-7-8-20(27)21(28)10-16/h1-2,5-8,10-11,13,15,29H,3-4,9,12,14H2 |
| InChIKey | KPBJLPKYQGNZIR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.79 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|