C27H27BClN5O — CID 88986761
CID 88986761 (PubChem CID 88986761) has the molecular formula C27H27BClN5O and a molecular weight of 483.81 g/mol.
| Compound Name | CID 88986761 |
|---|---|
| PubChem CID | 88986761 |
| Molecular Formula | C27H27BClN5O |
| Molecular Weight | 483.81 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCC3CCCN(CC4Cc5ccccc5O4)C3)cc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C27H27BClN5O/c28-22-15-31-34-26(13-24(32-27(22)34)21-8-2-3-9-23(21)29)30-14-18-6-5-11-33(16-18)17-20-12-19-7-1-4-10-25(19)35-20/h1-4,7-10,13,15,18,20,30H,5-6,11-12,14,16-17H2 |
| InChIKey | QANBZURWLPUECM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 54.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.81 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|