C26H33BN6O2 — CID 163809762
CID 163809762 (PubChem CID 163809762) has the molecular formula C26H33BN6O2 and a molecular weight of 472.40 g/mol.
| Compound Name | CID 163809762 |
|---|---|
| PubChem CID | 163809762 |
| Molecular Formula | C26H33BN6O2 |
| Molecular Weight | 472.40 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCC3CCCN(CCC(C4CC4)[N+]4([O-])CC4)C3)cc(-c3ccccc3O)nc12 |
| InChI | InChI=1S/C26H33BN6O2/c27-21-16-29-32-25(14-22(30-26(21)32)20-5-1-2-6-24(20)34)28-15-18-4-3-10-31(17-18)11-9-23(19-7-8-19)33(35)12-13-33/h1-2,5-6,14,16,18-19,23,28,34H,3-4,7-13,15,17H2 |
| InChIKey | IGCVBOGYWKXDAK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|