C26H25BClN7O2 — CID 89365510
CID 89365510 (PubChem CID 89365510) has the molecular formula C26H25BClN7O2 and a molecular weight of 513.80 g/mol.
| Compound Name | CID 89365510 |
|---|---|
| PubChem CID | 89365510 |
| Molecular Formula | C26H25BClN7O2 |
| Molecular Weight | 513.80 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCC3CCCN(C(=O)c4cccc(NC(N)=O)c4)C3)cc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C26H25BClN7O2/c27-20-14-31-35-23(12-22(33-24(20)35)19-8-1-2-9-21(19)28)30-13-16-5-4-10-34(15-16)25(36)17-6-3-7-18(11-17)32-26(29)37/h1-3,6-9,11-12,14,16,30H,4-5,10,13,15H2,(H3,29,32,37) |
| InChIKey | HIXRXNAIRLKKSU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 117.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.80 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|