C22H22F2N5O3PS — CID 143090770
5-fluoro-N-[2-[[3-[fluoro(methyl)phosphanyl]-5-(2-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-2-methylbenzenesulfonamide (PubChem CID 143090770) has the molecular formula C22H22F2N5O3PS and a molecular weight of 505.49 g/mol. Its IUPAC name is 5-fluoro-N-[2-[[3-[fluoro(methyl)phosphanyl]-5-(2-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-2-methylbenzenesulfonamide.
| Compound Name | 5-fluoro-N-[2-[[3-[fluoro(methyl)phosphanyl]-5-(2-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 143090770 |
| Molecular Formula | C22H22F2N5O3PS |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 5-fluoro-N-[2-[[3-[fluoro(methyl)phosphanyl]-5-(2-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)NCCNc1cc(-c2ccccc2O)nc2c(P(C)F)cnn12 |
| InChI | InChI=1S/C22H22F2N5O3PS/c1-14-7-8-15(23)11-20(14)34(31,32)27-10-9-25-21-12-17(16-5-3-4-6-18(16)30)28-22-19(33(2)24)13-26-29(21)22/h3-8,11-13,25,27,30H,9-10H2,1-2H3 |
| InChIKey | GYEOOCMMYLKAAQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|