C35H39N5O5Si — CID 70213964
methyl 4-[6-(1-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)-7-(2-trimethylsilylethoxymethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]oxybenzoate (PubChem CID 70213964) has the molecular formula C35H39N5O5Si and a molecular weight of 637.81 g/mol. Its IUPAC name is methyl 4-[6-(1-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)-7-(2-trimethylsilylethoxymethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]oxybenzoate.
| Compound Name | methyl 4-[6-(1-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)-7-(2-trimethylsilylethoxymethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]oxybenzoate |
|---|---|
| PubChem CID | 70213964 |
| Molecular Formula | C35H39N5O5Si |
| Molecular Weight | 637.81 g/mol |
| Exact Mass | 637.27 |
| IUPAC Name | methyl 4-[6-(1-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)-7-(2-trimethylsilylethoxymethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]oxybenzoate |
| SMILES | C=C(OCC)c1c(Oc2ccc(C(=O)OC)cc2)nc2c(-c3ccc(-c4ccccc4)nc3)cnn2c1NCOCC[Si](C)(C)C |
| InChI | InChI=1S/C35H39N5O5Si/c1-7-44-24(2)31-33(37-23-43-19-20-46(4,5)6)40-32(39-34(31)45-28-16-13-26(14-17-28)35(41)42-3)29(22-38-40)27-15-18-30(36-21-27)25-11-9-8-10-12-25/h8-18,21-22,37H,2,7,19-20,23H2,1,3-6H3 |
| InChIKey | VBMMWNJJILGIOC-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.81 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|