C41H64N6O4Si2 — CID 71135026
tert-butyl N-[(3R)-1-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-methyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]pentan-3-yl]-N-methylcarbamate (PubChem CID 71135026) has the molecular formula C41H64N6O4Si2 and a molecular weight of 761.17 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-methyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]pentan-3-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(3R)-1-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-methyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]pentan-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 71135026 |
| Molecular Formula | C41H64N6O4Si2 |
| Molecular Weight | 761.17 g/mol |
| Exact Mass | 760.45 |
| IUPAC Name | tert-butyl N-[(3R)-1-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-methyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]pentan-3-yl]-N-methylcarbamate |
| SMILES | CC[C@H](CCc1nc2c(-c3ccc(-c4ccccc4)nc3)cnn2c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c1C)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C41H64N6O4Si2/c1-13-34(45(6)40(48)51-41(3,4)5)20-22-36-31(2)39(46(29-49-23-25-52(7,8)9)30-50-24-26-53(10,11)12)47-38(44-36)35(28-43-47)33-19-21-37(42-27-33)32-17-15-14-16-18-32/h14-19,21,27-28,34H,13,20,22-26,29-30H2,1-12H3/t34-/m1/s1 |
| InChIKey | RPPARFKZRFKIOK-UUWRZZSWSA-N |
| XLogP | 9.78 |
| TPSA | 94.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.17 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|