C39H56N6O5Si2 — CID 123940085
4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(2-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylic acid (PubChem CID 123940085) has the molecular formula C39H56N6O5Si2 and a molecular weight of 745.09 g/mol. Its IUPAC name is 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(2-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylic acid.
| Compound Name | 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(2-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 123940085 |
| Molecular Formula | C39H56N6O5Si2 |
| Molecular Weight | 745.09 g/mol |
| Exact Mass | 744.39 |
| IUPAC Name | 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(2-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylic acid |
| SMILES | CCOC=Cc1c(C2CCN(C(=O)O)CC2)nc2c(-c3ccc(-c4ccccc4)nc3)cnn2c1N(COCC[Si](C)(C)C)COCC[Si](C)(C)C |
| InChI | InChI=1S/C39H56N6O5Si2/c1-8-48-21-18-33-36(31-16-19-43(20-17-31)39(46)47)42-37-34(32-14-15-35(40-26-32)30-12-10-9-11-13-30)27-41-45(37)38(33)44(28-49-22-24-51(2,3)4)29-50-23-25-52(5,6)7/h9-15,18,21,26-27,31H,8,16-17,19-20,22-25,28-29H2,1-7H3,(H,46,47) |
| InChIKey | MFFPDDZICNHZJT-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.09 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|