C38H51N7O4Si2 — CID 123570298
3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-cyano-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylic acid (PubChem CID 123570298) has the molecular formula C38H51N7O4Si2 and a molecular weight of 726.04 g/mol. Its IUPAC name is 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-cyano-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylic acid.
| Compound Name | 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-cyano-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylic acid |
|---|---|
| PubChem CID | 123570298 |
| Molecular Formula | C38H51N7O4Si2 |
| Molecular Weight | 726.04 g/mol |
| Exact Mass | 725.35 |
| IUPAC Name | 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-cyano-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1c(C#N)c(C2CC3CCC(C2)N3C(=O)O)nc2c(-c3ccc(-c4ccccc4)nc3)cnn12 |
| InChI | InChI=1S/C38H51N7O4Si2/c1-50(2,3)18-16-48-25-43(26-49-17-19-51(4,5)6)37-32(22-39)35(29-20-30-13-14-31(21-29)44(30)38(46)47)42-36-33(24-41-45(36)37)28-12-15-34(40-23-28)27-10-8-7-9-11-27/h7-12,15,23-24,29-31H,13-14,16-21,25-26H2,1-6H3,(H,46,47) |
| InChIKey | OFJGDGRLNFAJRF-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 129.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.04 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|