C41H59N5O3Si2 — CID 90227999
5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-6-[(Z)-2-ethoxyethenyl]-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 90227999) has the molecular formula C41H59N5O3Si2 and a molecular weight of 726.13 g/mol. Its IUPAC name is 5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-6-[(Z)-2-ethoxyethenyl]-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-6-[(Z)-2-ethoxyethenyl]-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 90227999 |
| Molecular Formula | C41H59N5O3Si2 |
| Molecular Weight | 726.13 g/mol |
| Exact Mass | 725.42 |
| IUPAC Name | 5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-6-[(Z)-2-ethoxyethenyl]-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCO/C=C\c1c(C2C[C@H]3CC[C@@H](C2)C3)nc2c(-c3ccc(-c4ccccc4)nc3)cnn2c1N(COCC[Si](C)(C)C)COCC[Si](C)(C)C |
| InChI | InChI=1S/C41H59N5O3Si2/c1-8-47-19-18-36-39(35-25-31-14-15-32(24-31)26-35)44-40-37(34-16-17-38(42-27-34)33-12-10-9-11-13-33)28-43-46(40)41(36)45(29-48-20-22-50(2,3)4)30-49-21-23-51(5,6)7/h9-13,16-19,27-28,31-32,35H,8,14-15,20-26,29-30H2,1-7H3/b19-18-/t31-,32+,35? |
| InChIKey | IGZRHZOOMAZNNW-SMBJHNSUSA-N |
| XLogP | 10.19 |
| TPSA | 74.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.13 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|