C38H52N6O2Si2 — CID 158085080
5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-6-isocyano-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 158085080) has the molecular formula C38H52N6O2Si2 and a molecular weight of 681.05 g/mol. Its IUPAC name is 5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-6-isocyano-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-6-isocyano-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 158085080 |
| Molecular Formula | C38H52N6O2Si2 |
| Molecular Weight | 681.05 g/mol |
| Exact Mass | 680.37 |
| IUPAC Name | 5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-6-isocyano-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | [C-]#[N+]c1c(C2C[C@H]3CC[C@@H](C2)C3)nc2c(-c3ccc(-c4ccccc4)nc3)cnn2c1N(COCC[Si](C)(C)C)COCC[Si](C)(C)C |
| InChI | InChI=1S/C38H52N6O2Si2/c1-39-36-35(32-22-28-13-14-29(21-28)23-32)42-37-33(31-15-16-34(40-24-31)30-11-9-8-10-12-30)25-41-44(37)38(36)43(26-45-17-19-47(2,3)4)27-46-18-20-48(5,6)7/h8-12,15-16,24-25,28-29,32H,13-14,17-23,26-27H2,2-7H3/t28-,29+,32? |
| InChIKey | VLOOFPOWBFTSMB-LSICZBSXSA-N |
| XLogP | 9.73 |
| TPSA | 69.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.05 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|