C38H55N5O3Si2 — CID 71128266
[5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-6-yl]methanol (PubChem CID 71128266) has the molecular formula C38H55N5O3Si2 and a molecular weight of 686.06 g/mol. Its IUPAC name is [5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-6-yl]methanol.
| Compound Name | [5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-6-yl]methanol |
|---|---|
| PubChem CID | 71128266 |
| Molecular Formula | C38H55N5O3Si2 |
| Molecular Weight | 686.06 g/mol |
| Exact Mass | 685.38 |
| IUPAC Name | [5-[(1R,5S)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-6-yl]methanol |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1c(CO)c(C2C[C@H]3CC[C@@H](C2)C3)nc2c(-c3ccc(-c4ccccc4)nc3)cnn12 |
| InChI | InChI=1S/C38H55N5O3Si2/c1-47(2,3)18-16-45-26-42(27-46-17-19-48(4,5)6)38-34(25-44)36(32-21-28-12-13-29(20-28)22-32)41-37-33(24-40-43(37)38)31-14-15-35(39-23-31)30-10-8-7-9-11-30/h7-11,14-15,23-24,28-29,32,44H,12-13,16-22,25-27H2,1-6H3/t28-,29+,32? |
| InChIKey | IHGVRDGJJWXNMY-LSICZBSXSA-N |
| XLogP | 8.68 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.06 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|