C39H60N6O2Si2 — CID 66879635
5-[(1-tert-butylpiperidin-4-yl)methyl]-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 66879635) has the molecular formula C39H60N6O2Si2 and a molecular weight of 701.12 g/mol. Its IUPAC name is 5-[(1-tert-butylpiperidin-4-yl)methyl]-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-[(1-tert-butylpiperidin-4-yl)methyl]-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 66879635 |
| Molecular Formula | C39H60N6O2Si2 |
| Molecular Weight | 701.12 g/mol |
| Exact Mass | 700.43 |
| IUPAC Name | 5-[(1-tert-butylpiperidin-4-yl)methyl]-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CC(C)(C)N1CCC(Cc2cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3ncc(-c4ccc(-c5ccccc5)nc4)c3n2)CC1 |
| InChI | InChI=1S/C39H60N6O2Si2/c1-39(2,3)44-19-17-31(18-20-44)25-34-26-37(43(29-46-21-23-48(4,5)6)30-47-22-24-49(7,8)9)45-38(42-34)35(28-41-45)33-15-16-36(40-27-33)32-13-11-10-12-14-32/h10-16,26-28,31H,17-25,29-30H2,1-9H3 |
| InChIKey | NTJYCYICBJPHSK-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 68.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.12 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|