C12H13N3 — CID 118428909
6-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]pyridine-2-carbonitrile (PubChem CID 118428909) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 6-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]pyridine-2-carbonitrile.
| Compound Name | 6-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 118428909 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 6-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]pyridine-2-carbonitrile |
| SMILES | C=C/C(=C\N(C)C)c1cccc(C#N)n1 |
| InChI | InChI=1S/C12H13N3/c1-4-10(9-15(2)3)12-7-5-6-11(8-13)14-12/h4-7,9H,1H2,2-3H3/b10-9+ |
| InChIKey | CTFWFEBPHFTRAE-MDZDMXLPSA-N |
| XLogP | 2.04 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|