C18H22ClF2N3O — CID 118429814
(2S)-1-[[5-(2-chloro-4-pyridinyl)-3-(difluoromethyl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-amine (PubChem CID 118429814) has the molecular formula C18H22ClF2N3O and a molecular weight of 369.84 g/mol. Its IUPAC name is (2S)-1-[[5-(2-chloro-4-pyridinyl)-3-(difluoromethyl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-amine.
| Compound Name | (2S)-1-[[5-(2-chloro-4-pyridinyl)-3-(difluoromethyl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 118429814 |
| Molecular Formula | C18H22ClF2N3O |
| Molecular Weight | 369.84 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | (2S)-1-[[5-(2-chloro-4-pyridinyl)-3-(difluoromethyl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-amine |
| SMILES | CC(C)C[C@](C)(N)COc1ncc(-c2ccnc(Cl)c2)cc1C(F)F |
| InChI | InChI=1S/C18H22ClF2N3O/c1-11(2)8-18(3,22)10-25-17-14(16(20)21)6-13(9-24-17)12-4-5-23-15(19)7-12/h4-7,9,11,16H,8,10,22H2,1-3H3/t18-/m0/s1 |
| InChIKey | ZCHJRHXGHGSPDX-SFHVURJKSA-N |
| XLogP | 4.88 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.84 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|