About 4-[(1S,2R)-2-aminocyclopropyl]-5-methyl-N-(oxan-4-yl)thiophene-2-carboxamide
4-[(1S,2R)-2-aminocyclopropyl]-5-methyl-N-(oxan-4-yl)thiophene-2-carboxamide (PubChem CID 118432628) has the molecular formula C14H20N2O2S
and a molecular weight of 280.39 g/mol. Its IUPAC name is 4-[(1S,2R)-2-aminocyclopropyl]-5-methyl-N-(oxan-4-yl)thiophene-2-carboxamide.
Molecular Properties
| Compound Name | 4-[(1S,2R)-2-aminocyclopropyl]-5-methyl-N-(oxan-4-yl)thiophene-2-carboxamide |
| PubChem CID | 118432628 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4-[(1S,2R)-2-aminocyclopropyl]-5-methyl-N-(oxan-4-yl)thiophene-2-carboxamide |
| SMILES | Cc1sc(C(=O)NC2CCOCC2)cc1[C@@H]1C[C@H]1N |
| InChI | InChI=1S/C14H20N2O2S/c1-8-10(11-6-12(11)15)7-13(19-8)14(17)16-9-2-4-18-5-3-9/h7,9,11-12H,2-6,15H2,1H3,(H,16,17)/t11-,12+/m0/s1 |
| InChIKey | ZXGDVLZCUVXYCM-NWDGAFQWSA-N |
| XLogP | 1.78 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(1S,2R)-2-aminocyclopropyl]-5-methyl-N-(oxan-4-yl)thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1S,2R)-2-aminocyclopropyl]-5-methyl-N-(oxan-4-yl)thiophene-2-carboxamide?
The IUPAC name of 4-[(1S,2R)-2-aminocyclopropyl]-5-methyl-N-(oxan-4-yl)thiophene-2-carboxamide (CID 118432628) is 4-[(1S,2R)-2-aminocyclopropyl]-5-methyl-N-(oxan-4-yl)thiophene-2-carboxamide.
What is the SMILES notation for 4-[(1S,2R)-2-aminocyclopropyl]-5-methyl-N-(oxan-4-yl)thiophene-2-carboxamide?
The canonical SMILES for 4-[(1S,2R)-2-aminocyclopropyl]-5-methyl-N-(oxan-4-yl)thiophene-2-carboxamide is Cc1sc(C(=O)NC2CCOCC2)cc1[C@@H]1C[C@H]1N.
What is the InChIKey of 4-[(1S,2R)-2-aminocyclopropyl]-5-methyl-N-(oxan-4-yl)thiophene-2-carboxamide?
The InChIKey is ZXGDVLZCUVXYCM-NWDGAFQWSA-N. The full InChI is InChI=1S/C14H20N2O2S/c1-8-10(11-6-12(11)15)7-13(19-8)14(17)16-9-2-4-18-5-3-9/h7,9,11-12H,2-6,15H2,1H3,(H,16,17)/t11-,12+/m0/s1.
What are the key properties of 4-[(1S,2R)-2-aminocyclopropyl]-5-methyl-N-(oxan-4-yl)thiophene-2-carboxamide?
4-[(1S,2R)-2-aminocyclopropyl]-5-methyl-N-(oxan-4-yl)thiophene-2-carboxamide has a molecular weight of 280.39 g/mol, XLogP of 1.78, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1S,2R)-2-aminocyclopropyl]-5-methyl-N-(oxan-4-yl)thiophene-2-carboxamide is sourced from PubChem (CID 118432628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).