C14H14F3NO3S — CID 118434458
4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane-2-carbonitrile (PubChem CID 118434458) has the molecular formula C14H14F3NO3S and a molecular weight of 333.33 g/mol. Its IUPAC name is 4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane-2-carbonitrile.
| Compound Name | 4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane-2-carbonitrile |
|---|---|
| PubChem CID | 118434458 |
| Molecular Formula | C14H14F3NO3S |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane-2-carbonitrile |
| SMILES | CC1(S(=O)(=O)c2cccc(C(F)(F)F)c2)CCOC(C#N)C1 |
| InChI | InChI=1S/C14H14F3NO3S/c1-13(5-6-21-11(8-13)9-18)22(19,20)12-4-2-3-10(7-12)14(15,16)17/h2-4,7,11H,5-6,8H2,1H3 |
| InChIKey | CULRNGCREGKNIZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |