C34H35FN2O5 — CID 118435133
methyl 3-[[2-[(2-acetamidoethylamino)methyl]-5-[(2-methyl-3-phenylphenyl)methoxy]phenoxy]methyl]-4-fluorobenzoate (PubChem CID 118435133) has the molecular formula C34H35FN2O5 and a molecular weight of 570.66 g/mol. Its IUPAC name is methyl 3-[[2-[(2-acetamidoethylamino)methyl]-5-[(2-methyl-3-phenylphenyl)methoxy]phenoxy]methyl]-4-fluorobenzoate.
| Compound Name | methyl 3-[[2-[(2-acetamidoethylamino)methyl]-5-[(2-methyl-3-phenylphenyl)methoxy]phenoxy]methyl]-4-fluorobenzoate |
|---|---|
| PubChem CID | 118435133 |
| Molecular Formula | C34H35FN2O5 |
| Molecular Weight | 570.66 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | methyl 3-[[2-[(2-acetamidoethylamino)methyl]-5-[(2-methyl-3-phenylphenyl)methoxy]phenoxy]methyl]-4-fluorobenzoate |
| SMILES | COC(=O)c1ccc(F)c(COc2cc(OCc3cccc(-c4ccccc4)c3C)ccc2CNCCNC(C)=O)c1 |
| InChI | InChI=1S/C34H35FN2O5/c1-23-28(10-7-11-31(23)25-8-5-4-6-9-25)21-41-30-14-12-27(20-36-16-17-37-24(2)38)33(19-30)42-22-29-18-26(34(39)40-3)13-15-32(29)35/h4-15,18-19,36H,16-17,20-22H2,1-3H3,(H,37,38) |
| InChIKey | AFMJWNSKRLXUDC-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.66 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|