C34H48N4O7 — CID 11843768
benzyl (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S,3S)-2-acetamido-3-methylpentanoyl]-hydroxyamino]-3-methylbutanoyl]amino]-3-methylbutanoyl]amino]-3-phenylpropanoate (PubChem CID 11843768) has the molecular formula C34H48N4O7 and a molecular weight of 624.78 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S,3S)-2-acetamido-3-methylpentanoyl]-hydroxyamino]-3-methylbutanoyl]amino]-3-methylbutanoyl]amino]-3-phenylpropanoate.
| Compound Name | benzyl (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S,3S)-2-acetamido-3-methylpentanoyl]-hydroxyamino]-3-methylbutanoyl]amino]-3-methylbutanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 11843768 |
| Molecular Formula | C34H48N4O7 |
| Molecular Weight | 624.78 g/mol |
| Exact Mass | 624.35 |
| IUPAC Name | benzyl (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S,3S)-2-acetamido-3-methylpentanoyl]-hydroxyamino]-3-methylbutanoyl]amino]-3-methylbutanoyl]amino]-3-phenylpropanoate |
| SMILES | CC[C@H](C)[C@H](NC(C)=O)C(=O)N(O)[C@H](C(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)OCc1ccccc1)C(C)C)C(C)C |
| InChI | InChI=1S/C34H48N4O7/c1-8-23(6)29(35-24(7)39)33(42)38(44)30(22(4)5)32(41)37-28(21(2)3)31(40)36-27(19-25-15-11-9-12-16-25)34(43)45-20-26-17-13-10-14-18-26/h9-18,21-23,27-30,44H,8,19-20H2,1-7H3,(H,35,39)(H,36,40)(H,37,41)/t23-,27-,28-,29-,30-/m0/s1 |
| InChIKey | YTYXFFZEWCLMJT-LTUSVDMXSA-N |
| XLogP | 3.39 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.78 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|