C33H39N3O5 — CID 145189762
benzyl (2S)-2-[[2-[[(2S)-2-formamido-4-phenylbutanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoate (PubChem CID 145189762) has the molecular formula C33H39N3O5 and a molecular weight of 557.69 g/mol. Its IUPAC name is benzyl (2S)-2-[[2-[[(2S)-2-formamido-4-phenylbutanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoate.
| Compound Name | benzyl (2S)-2-[[2-[[(2S)-2-formamido-4-phenylbutanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 145189762 |
| Molecular Formula | C33H39N3O5 |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.29 |
| IUPAC Name | benzyl (2S)-2-[[2-[[(2S)-2-formamido-4-phenylbutanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoate |
| SMILES | CCC(C)C(NC(=O)[C@H](CCc1ccccc1)NC=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H39N3O5/c1-3-24(2)30(36-31(38)28(34-23-37)20-19-25-13-7-4-8-14-25)32(39)35-29(21-26-15-9-5-10-16-26)33(40)41-22-27-17-11-6-12-18-27/h4-18,23-24,28-30H,3,19-22H2,1-2H3,(H,34,37)(H,35,39)(H,36,38)/t24?,28-,29-,30?/m0/s1 |
| InChIKey | NTIZHPREWIAUDK-GICVFCHBSA-N |
| XLogP | 3.74 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|