C28H25N3O — CID 118438364
N-[4-(3-methyl-5-phenanthren-3-ylpyrazol-1-yl)phenyl]butanamide (PubChem CID 118438364) has the molecular formula C28H25N3O and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[4-(3-methyl-5-phenanthren-3-ylpyrazol-1-yl)phenyl]butanamide.
| Compound Name | N-[4-(3-methyl-5-phenanthren-3-ylpyrazol-1-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 118438364 |
| Molecular Formula | C28H25N3O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | N-[4-(3-methyl-5-phenanthren-3-ylpyrazol-1-yl)phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(-n2nc(C)cc2-c2ccc3ccc4ccccc4c3c2)cc1 |
| InChI | InChI=1S/C28H25N3O/c1-3-6-28(32)29-23-13-15-24(16-14-23)31-27(17-19(2)30-31)22-12-11-21-10-9-20-7-4-5-8-25(20)26(21)18-22/h4-5,7-18H,3,6H2,1-2H3,(H,29,32) |
| InChIKey | QBZZTTILFPNERQ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|