C33H27N5O2 — CID 86280747
1-[4-[(2-aminoacetyl)amino]phenyl]-N-benzyl-5-phenanthren-3-ylpyrazole-3-carboxamide (PubChem CID 86280747) has the molecular formula C33H27N5O2 and a molecular weight of 525.61 g/mol. Its IUPAC name is 1-[4-[(2-aminoacetyl)amino]phenyl]-N-benzyl-5-phenanthren-3-ylpyrazole-3-carboxamide.
| Compound Name | 1-[4-[(2-aminoacetyl)amino]phenyl]-N-benzyl-5-phenanthren-3-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 86280747 |
| Molecular Formula | C33H27N5O2 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | 1-[4-[(2-aminoacetyl)amino]phenyl]-N-benzyl-5-phenanthren-3-ylpyrazole-3-carboxamide |
| SMILES | NCC(=O)Nc1ccc(-n2nc(C(=O)NCc3ccccc3)cc2-c2ccc3ccc4ccccc4c3c2)cc1 |
| InChI | InChI=1S/C33H27N5O2/c34-20-32(39)36-26-14-16-27(17-15-26)38-31(19-30(37-38)33(40)35-21-22-6-2-1-3-7-22)25-13-12-24-11-10-23-8-4-5-9-28(23)29(24)18-25/h1-19H,20-21,34H2,(H,35,40)(H,36,39) |
| InChIKey | ABPWQIOJIVZWFI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|