C27H25N5O3 — CID 55824547
5-(4-methoxyphenyl)-1-phenyl-N-[4-(prop-2-enylcarbamoylamino)phenyl]pyrazole-3-carboxamide (PubChem CID 55824547) has the molecular formula C27H25N5O3 and a molecular weight of 467.53 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-1-phenyl-N-[4-(prop-2-enylcarbamoylamino)phenyl]pyrazole-3-carboxamide.
| Compound Name | 5-(4-methoxyphenyl)-1-phenyl-N-[4-(prop-2-enylcarbamoylamino)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55824547 |
| Molecular Formula | C27H25N5O3 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 5-(4-methoxyphenyl)-1-phenyl-N-[4-(prop-2-enylcarbamoylamino)phenyl]pyrazole-3-carboxamide |
| SMILES | C=CCNC(=O)Nc1ccc(NC(=O)c2cc(-c3ccc(OC)cc3)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C27H25N5O3/c1-3-17-28-27(34)30-21-13-11-20(12-14-21)29-26(33)24-18-25(19-9-15-23(35-2)16-10-19)32(31-24)22-7-5-4-6-8-22/h3-16,18H,1,17H2,2H3,(H,29,33)(H2,28,30,34) |
| InChIKey | MZWZLPWXTHYCPN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|