C23H17ClN6O2 — CID 10049148
N-(4-azidophenyl)-5-(4-chlorophenyl)-1-(4-methoxyphenyl)pyrazole-3-carboxamide (PubChem CID 10049148) has the molecular formula C23H17ClN6O2 and a molecular weight of 444.88 g/mol. Its IUPAC name is N-(4-azidophenyl)-5-(4-chlorophenyl)-1-(4-methoxyphenyl)pyrazole-3-carboxamide.
| Compound Name | N-(4-azidophenyl)-5-(4-chlorophenyl)-1-(4-methoxyphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 10049148 |
| Molecular Formula | C23H17ClN6O2 |
| Molecular Weight | 444.88 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | N-(4-azidophenyl)-5-(4-chlorophenyl)-1-(4-methoxyphenyl)pyrazole-3-carboxamide |
| SMILES | COc1ccc(-n2nc(C(=O)Nc3ccc(N=[N+]=[N-])cc3)cc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H17ClN6O2/c1-32-20-12-10-19(11-13-20)30-22(15-2-4-16(24)5-3-15)14-21(28-30)23(31)26-17-6-8-18(9-7-17)27-29-25/h2-14H,1H3,(H,26,31) |
| InChIKey | BQYAFTYQSJFBIH-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.88 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|